Systematic / IUPAC Name: 3,6-Dichloro-2-hydroxybenzoic acid
ID: Reference13661
Other Names: AA-2573
Formula: C7H4Cl2O3
Class: Pesticides/Herbicides
3,6-Dichlorosalicylic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 252 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/21/2025 10:34:49 AM |
| InChI | InChI=1S/C7H4Cl2O3/c8-3-1-2-4(9)6(10)5(3)7(11)12/h1-2,10H,(H,11,12) |
| InChI Key | FKIKPQHMWFZFEB-UHFFFAOYSA-N |
| Canonical SMILES | O=C(O)c1c(Cl)ccc(Cl)c1O |
| CAS | |
| Splash | |
| Other Names | AA-2573 |
| PubChem | 18844 |
| ChEMBL | CHEMBL1233461 |
| ChemSpider | 17793 |