Systematic / IUPAC Name: [5,6-Dimethyl-2-(methylamino)pyrimidin-4-yl] N,N-dimethylcarbamate
ID: Reference13666
Other Names:
5,6-Dimethyl-2-(methylamino)-4-pyrimidinyl dimethylcarbamate;
AA-2575
Formula: C10H16N4O2
Class: Pesticides/Herbicides
Pirimicarb-desmethyl mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 674 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/28/2025 12:35:46 PM |
| InChI | InChI=1S/C10H16N4O2/c1-6-7(2)12-9(11-3)13-8(6)16-10(15)14(4)5/h1-5H3,(H,11,12,13) |
| InChI Key | GTKRZJVAXAQBMB-UHFFFAOYSA-N |
| Canonical SMILES | CNc1nc(C)c(C)c(OC(=O)N(C)C)n1 |
| CAS | |
| Splash | |
| Other Names |
5,6-Dimethyl-2-(methylamino)-4-pyrimidinyl dimethylcarbamate; AA-2575 |