Systematic / IUPAC Name: Methyl 2-[4-(2,4-dichlorophenoxy)phenoxy]propanoate
ID: Reference13686
Other Names: AA-2462
Formula: C16H14Cl2O4
Class: Pesticides/Herbicides
Diclofop-methyl mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2171 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 12/15/2025 10:30:22 AM |
| InChI | InChI=1S/C16H14Cl2O4/c1-10(16(19)20-2)21-12-4-6-13(7-5-12)22-15-8-3-11(17)9-14(15)18/h3-10H,1-2H3 |
| InChI Key | BACHBFVBHLGWSL-UHFFFAOYSA-N |
| Canonical SMILES | COC(=O)C(C)Oc1ccc(Oc2ccc(Cl)cc2Cl)cc1 |
| CAS | |
| Splash | |
| Other Names | AA-2462 |
| ChEBI | CHEBI:145412 |
| ChemSpider | 36557 |
| ChEMBL | CHEMBL34474 |
| PubChem | 39985 |
| KEGG | C11021 |
| DrugBank | DB13918 |