Systematic / IUPAC Name:
ID: Reference13703
Other Names: 9AntTSKPh
Formula: C22H17N3S
3-[(E)-[(Anthracen-9-yl)methylidene]amino]-1-phenylthiourea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD |
| No. of Spectral Trees | 2 |
| No. of Spectra | 1516 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/2/2026 10:21:13 AM |
| InChI | InChI=1S/C22H17N3S/c26-22(24-18-10-2-1-3-11-18)25-23-15-21-19-12-6-4-8-16(19)14-17-9-5-7-13-20(17)21/h1-15H,(H2,24,25,26)/b23-15+ |
| InChI Key | IOXANBGTOKHNTB-HZHRSRAPSA-N |
| Canonical SMILES | S=C(Nc1ccccc1)N/N=C/c1c2ccccc2cc2ccccc21 |
| CAS | |
| Splash | |
| Other Names | 9AntTSKPh |