Systematic / IUPAC Name:
ID: Reference13712
Other Names: 9AntMBAMe
Formula: C19H15N3OS
(2Z)-2-[(2E)-2-[(Anthracen-9-yl)methylidene]hydrazin-1-ylidene]-3-methyl-1,3-thiazolidin-4-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD |
| No. of Spectral Trees | 1 |
| No. of Spectra | 520 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/7/2026 11:21:39 AM |
| InChI | InChI=1S/C19H15N3OS/c1-22-18(23)12-24-19(22)21-20-11-17-15-8-4-2-6-13(15)10-14-7-3-5-9-16(14)17/h2-11H,12H2,1H3/b20-11+,21-19- |
| InChI Key | JMGQSSFBTCXFHR-YOPNLDQXSA-N |
| Canonical SMILES | CN1C(=N\N=C\c2c3ccccc3cc3ccccc32)\SCC1=O |
| CAS | |
| Splash | |
| Other Names | 9AntMBAMe |