Systematic / IUPAC Name: 2-Acetamidopentanoic acid
ID: Reference1373
Other Names:
N-Acetyl-2-aminovaleric acid;
N-Acetylnorvaline
Formula: C7H13NO3
Class: Endogenous Metabolites
N-Acetyl-DL-norvaline mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 99 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/4/2014 7:56:59 AM |
| InChI | InChI=1S/C7H13NO3/c1-3-4-6(7(10)11)8-5(2)9/h6H,3-4H2,1-2H3,(H,8,9)(H,10,11) |
| InChI Key | BSYFPUSAWVWWDG-UHFFFAOYSA-N |
| Canonical SMILES | CCCC(C(=O)O)NC(=O)C |
| CAS | 7682157 |
| Splash | |
| Other Names |
N-Acetyl-2-aminovaleric acid; N-Acetylnorvaline |