Systematic / IUPAC Name: (2,4-Dichlorophenyl)methanol
ID: Reference13750
Other Names:
AA-3747;
Dichlorobenzyl alcohol
Formula: C7H6Cl2O
Class: Endogenous Metabolites
2,4-Dichlorobenzyl alcohol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 105 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/28/2026 12:20:24 PM |
| InChI | InChI=1S/C7H6Cl2O/c8-6-2-1-5(4-10)7(9)3-6/h1-3,10H,4H2 |
| InChI Key | DBHODFSFBXJZNY-UHFFFAOYSA-N |
| Canonical SMILES | OCc1ccc(Cl)cc1Cl |
| CAS | |
| Splash | |
| Other Names |
AA-3747; Dichlorobenzyl alcohol |
| ChEMBL | CHEMBL3184437 |
| ChEBI | CHEBI:48220 |
| PubChem | 15684 |
| ChemSpider | 14918 |
| DrugBank | DB13269 |