Systematic / IUPAC Name: [[(2R,3S,4R,5R)-5-(6-Aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(2R,3S,4R,5R)-5-(3-carbamoyl-4H-pyridin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate
ID: Reference13753
Other Names:
Coenzyme I, reduced;
Reduced nicotinamide-adenine dinucleotide;
Reduced nicotinamide adenine diphosphate;
AA-4029
Formula: C21H29N7O14P2
Class: Endogenous Metabolites
NADH mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2342 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/23/2026 4:26:39 PM |
| InChI | InChI=1S/C21H29N7O14P2/c22-17-12-19(25-7-24-17)28(8-26-12)21-16(32)14(30)11(41-21)6-39-44(36,37)42-43(34,35)38-5-10-13(29)15(31)20(40-10)27-3-1-2-9(4-27)18(23)33/h1,3-4,7-8,10-11,13-16,20-21,29-32H,2,5-6H2,(H2,23,33)(H,34,35)(H,36,37)(H2,22,24,25)/t10-,11-,13-,14-,15-,16-,20-,21-/m1/s1 |
| InChI Key | BOPGDPNILDQYTO-NNYOXOHSSA-N |
| Canonical SMILES | NC(=O)C1=CN([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)OC[C@H]3O[C@@H](n4cnc5c(N)ncnc54)[C@H](O)[C@@H]3O)[C@@H](O)[C@H]2O)C=CC1 |
| CAS | |
| Splash | |
| Other Names |
Coenzyme I, reduced; Reduced nicotinamide-adenine dinucleotide; Reduced nicotinamide adenine diphosphate; AA-4029 |
| Wikipedia | NADH |
| PubChem | 439153 |
| ChemSpider | 388299 |
| HMDb | HMDB0001487 |
| ChEBI | CHEBI:16908 |
| ChEMBL | CHEMBL1234616 |
| DrugBank | DB00157 |
| KEGG | C00004 |