Systematic / IUPAC Name: (2E,4E)-5-[(1S)-1-Hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl]-3-methylpenta-2,4-dienoic acid
ID: Reference13822
Other Names:
(S)-2-trans-Abscisic acid;
AA-4117
Formula: C15H20O4
Class: Endogenous Metabolites
(S)-(+)-Abscisic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 657 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/16/2026 7:21:40 PM |
| InChI | InChI=1S/C15H20O4/c1-10(7-13(17)18)5-6-15(19)11(2)8-12(16)9-14(15,3)4/h5-8,19H,9H2,1-4H3,(H,17,18)/b6-5+,10-7+/t15-/m1/s1 |
| InChI Key | JLIDBLDQVAYHNE-IBPUIESWSA-N |
| Canonical SMILES | CC1=CC(=O)CC(C)(C)[C@@]1(O)/C=C/C(C)=C/C(=O)O |
| CAS | |
| Splash | |
| Other Names |
(S)-2-trans-Abscisic acid; AA-4117 |
| ChEBI | CHEBI:18743 |
| ChemSpider | 4642916 |
| PubChem | 5702609 |
| HMDb | HMDB0035140 |