Systematic / IUPAC Name: (2S)-2-(Carbamoylamino)butanedioic acid
ID: Reference13841
Other Names:
Carbamoylaspartate;
N-Carbamoyl-L-aspartic acid;
AA-4348
Formula: C5H8N2O5
Class: Endogenous Metabolites
Ureidosuccinic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 214 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/27/2026 11:01:07 AM |
| InChI | InChI=1S/C5H8N2O5/c6-5(12)7-2(4(10)11)1-3(8)9/h2H,1H2,(H,8,9)(H,10,11)(H3,6,7,12)/t2-/m0/s1 |
| InChI Key | HLKXYZVTANABHZ-REOHCLBHSA-N |
| Canonical SMILES | NC(=O)N[C@@H](CC(=O)O)C(=O)O |
| CAS | |
| Splash | |
| Other Names |
Carbamoylaspartate; N-Carbamoyl-L-aspartic acid; AA-4348 |
| DrugBank | DB04252; DB04252 |
| ChEBI | CHEBI:15859 |
| KEGG | C00438 |
| ChemSpider | 84022 |
| PubChem | 93072 |
| HMDb | HMDB0000828; HMDB0000828 |