Systematic / IUPAC Name: 2-Hydroxy-4-methylbenzaldehyde
ID: Reference13862
Other Names: AA-4265
Formula: C8H8O2
Class: Endogenous Metabolites
4-Methylsalicylaldehyde mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 453 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/8/2026 1:49:27 PM |
| InChI | InChI=1S/C8H8O2/c1-6-2-3-7(5-9)8(10)4-6/h2-5,10H,1H3 |
| InChI Key | JODRRPJMQDFCBJ-UHFFFAOYSA-N |
| Canonical SMILES | Cc1ccc(C=O)c(O)c1 |
| CAS | |
| Splash | |
| Other Names | AA-4265 |
| ChemSpider | 55144 |
| PubChem | 61200; 61200 |
| HMDb | HMDB0032603 |