Systematic / IUPAC Name: (2S)-2,3-Diaminopropanoic acid
ID: Reference13865
Other Names:
L-α,β-Diaminopropionic acid;
L-2,3-Diaminopropanoic acid;
AA-4145
Formula: C3H8N2O2
Class: Endogenous Metabolites
3-Amino-L-alanine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 203 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/8/2026 8:54:02 AM |
| InChI | InChI=1S/C3H8N2O2/c4-1-2(5)3(6)7/h2H,1,4-5H2,(H,6,7)/t2-/m0/s1 |
| InChI Key | PECYZEOJVXMISF-REOHCLBHSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names |
L-α,β-Diaminopropionic acid; L-2,3-Diaminopropanoic acid; AA-4145 |
| HMDb | HMDB0002006; HMDB0002006; HMDB0002006 |
| Wikipedia | 2,3-Diaminopropionic_acid |
| ChEMBL | CHEMBL103247 |
| LipidsMAPs | LMFA01100051 |
| PubChem | 46906042 |
| ChEBI | CHEBI:57721 |
| KEGG | C03401 |
| ChemSpider | 87849 |