Systematic / IUPAC Name: 2-Methylpentanedioic acid
ID: Reference139
Other Names:
Pentanedioic acid, 2-methyl-;
α-Methylglutaric acid;
Glutaric acid, 2-methyl-;
2-Methylglutarate;
α-Methylglutarate
Formula: C6H10O4
Class: Endogenous Metabolites
2-Methylglutaric acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 145 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/6/2014 11:12:53 AM |
| InChI | InChI=1S/C6H10O4/c1-4(6(9)10)2-3-5(7)8/h4H,2-3H2,1H3,(H,7,8)(H,9,10) |
| InChI Key | AQYCMVICBNBXNA-UHFFFAOYSA-N |
| Canonical SMILES | CC(CCC(=O)O)C(=O)O |
| CAS | 18069175 |
| Splash | |
| Other Names |
Pentanedioic acid, 2-methyl-; α-Methylglutaric acid; Glutaric acid, 2-methyl-; 2-Methylglutarate; α-Methylglutarate |
| ChemIDPlus | 000617629; 018069175 |
| ChEMBL | CHEMBL1971317 |
| PubChem | 12046 |
| ChemSpider | 11549 |
| ChEBI | CHEBI:68567 |
| HMDb | HMDB00422; HMDB00422; HMDB00752 |
| KEGG | C05282 |