Systematic / IUPAC Name: 2-(4-Methoxyphenyl)acetic acid
ID: Reference13926
Other Names:
4-Methoxyphenylacetic acid;
AA-4518
Formula: C9H10O3
Class: Endogenous Metabolites
Homoanisic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 224 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/29/2026 8:30:58 AM |
| InChI | InChI=1S/C9H10O3/c1-12-8-4-2-7(3-5-8)6-9(10)11/h2-5H,6H2,1H3,(H,10,11) |
| InChI Key | NRPFNQUDKRYCNX-UHFFFAOYSA-N |
| Canonical SMILES | COc1ccc(CC(=O)O)cc1 |
| CAS | |
| Splash | |
| Other Names |
4-Methoxyphenylacetic acid; AA-4518 |
| HMDb | HMDB0002072; HMDB0002072; HMDB0002072; HMDB0002072 |
| ChEMBL | CHEMBL1760597 |
| PubChem | 7690; 7690 |
| ChemSpider | 7406 |
| ChEBI | CHEBI:55501 |