Systematic / IUPAC Name: 1,2,4-Trimethoxybenzene
ID: Reference13960
Other Names: AA-4774
Formula: C9H12O3
Class: Endogenous Metabolites
1,2,4-Trimethoxybenzene mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1020 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 6/26/2026 2:05:31 PM |
| InChI | InChI=1S/C9H12O3/c1-10-7-4-5-8(11-2)9(6-7)12-3/h4-6H,1-3H3 |
| InChI Key | AGIQIOSHSMJYJP-UHFFFAOYSA-N |
| Canonical SMILES | COc1ccc(OC)c(OC)c1 |
| CAS | |
| Splash | |
| Other Names | AA-4774 |
| ChEMBL | CHEMBL1668605 |
| PubChem | 67284; 67284 |
| ChemSpider | 425; 60616 |