Systematic / IUPAC Name: Diethyl 2,3-dihydroxybutanedioate
ID: Reference13968
Other Names:
Butanedioic acid, 2,3-dihydroxy-, diethyl ester, [S-(R*,R*)]-;
L-(+)-(Diethyl tartrate);
AA-4806
Formula: C8H14O6
Class: Endogenous Metabolites
Diethyl tartrate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 996 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/1/2026 3:36:53 PM |
| InChI | InChI=1S/C8H14O6/c1-3-13-7(11)5(9)6(10)8(12)14-4-2/h5-6,9-10H,3-4H2,1-2H3 |
| InChI Key | YSAVZVORKRDODB-UHFFFAOYSA-N |
| Canonical SMILES | CCOC(=O)C(O)C(O)C(=O)OCC |
| CAS | |
| Splash | |
| Other Names |
Butanedioic acid, 2,3-dihydroxy-, diethyl ester, [S-(R*,R*)]-; L-(+)-(Diethyl tartrate); AA-4806 |
| ChemSpider | 13871489 |
| HMDb | HMDB0033584 |
| PubChem | 62333; 62333 |