Systematic / IUPAC Name: [(1R,5S)-8-Methyl-8-azabicyclo[3.2.1]octan-3-yl] (2S)-3-hydroxy-2-phenylpropanoate
ID: Reference13970
Other Names:
Benzeneacetic acid, α-(hydroxymethyl)-, (3-endo)-8-methyl-8-azabicyclo[3.2.1]oct-3-yl ester, ( α S)-;
[(1S,5R)-8-Methyl-8-azabicyclo[3.2.1]octan-3-yl] (2S)-3-hydroxy-2-phenylpropanoate;
AA-3770
Formula: C17H23NO3
Class: Endogenous Metabolites
Atropine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 520 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/1/2026 3:18:17 PM |
| InChI | InChI=1S/C17H23NO3/c1-18-13-7-8-14(18)10-15(9-13)21-17(20)16(11-19)12-5-3-2-4-6-12/h2-6,13-16,19H,7-11H2,1H3/t13-,14+,15?,16-/m1/s1 |
| InChI Key | RKUNBYITZUJHSG-VFSICIBPSA-N |
| Canonical SMILES | CN1[C@@H]2CC[C@H]1CC(OC(=O)[C@H](CO)c1ccccc1)C2 |
| CAS | |
| Splash | |
| Other Names |
Benzeneacetic acid, α-(hydroxymethyl)-, (3-endo)-8-methyl-8-azabicyclo[3.2.1]oct-3-yl ester, ( α S)-; [(1S,5R)-8-Methyl-8-azabicyclo[3.2.1]octan-3-yl] (2S)-3-hydroxy-2-phenylpropanoate; AA-3770 |
| PubChem | 154417; 154417 |
| ChEMBL | CHEMBL2449003 |
| ChemSpider | 136044 |
| ChEBI | CHEBI:92712 |