Systematic / IUPAC Name: 2-[[(4R)-4-[(3R,5R,8R,9S,10S,13R,14S,17R)-3-Hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]amino]acetic acid
ID: Reference14025
Other Names:
Lithocholic acid glycine conjugate;
AA-2651
Formula: C26H43NO4
Class: Therapeutics/Prescription Drugs Steroids/Vitamins/Hormones Endogenous Metabolites
Glycolithocholic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 704 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/7/2026 8:56:05 AM |
| InChI | InChI=1S/C26H43NO4/c1-16(4-9-23(29)27-15-24(30)31)20-7-8-21-19-6-5-17-14-18(28)10-12-25(17,2)22(19)11-13-26(20,21)3/h16-22,28H,4-15H2,1-3H3,(H,27,29)(H,30,31)/t16-,17-,18-,19+,20-,21+,22+,25+,26-/m1/s1 |
| InChI Key | XBSQTYHEGZTYJE-OETIFKLTSA-N |
| Canonical SMILES | C[C@H](CCC(=O)NCC(=O)O)[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |
| CAS | |
| Splash | |
| Other Names |
Lithocholic acid glycine conjugate; AA-2651 |
| PubChem | 115245 |
| KEGG | C15557 |
| ChemSpider | 103116 |
| ChEBI | CHEBI:37998 |
| ChEMBL | CHEMBL258818 |
| HMDb | HMDB0000698; HMDB0000698 |