Systematic / IUPAC Name: (2E)-3-Phenylacrylic acid
ID: Reference1403
Other Names:
trans-3-Phenylacrylic acid;
trans-3-Phenyl-2-propenoic acid;
2-Propenoic acid, 3-phenyl-, (E)-;
β-Phenylacrylic acid;
(2E)-3-Phenyl-2-propenoic acid
; more
Formula: C9H8O2
Class: Endogenous Metabolites Personal Care Products/Cosmetics Excipients/Additives/Colorants
trans-Cinnamic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 110 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/3/2014 2:52:37 PM |
| InChI | InChI=1S/C9H8O2/c10-9(11)7-6-8-4-2-1-3-5-8/h1-7H,(H,10,11)/b7-6+ |
| InChI Key | WBYWAXJHAXSJNI-VOTSOKGWSA-N |
| Canonical SMILES | |
| CAS | 621829 |
| Splash | |
| Other Names |
trans-3-Phenylacrylic acid; trans-3-Phenyl-2-propenoic acid; 2-Propenoic acid, 3-phenyl-, (E)-; β-Phenylacrylic acid; (2E)-3-Phenyl-2-propenoic acid; Benzeneacrylic acid; 2-Propenoic acid, 3-phenyl-, (2E)-; (2E)-2-Phenyl-2-propenoate; (E)-Cinnamic acid; trans-Cinnamate; Cinnamic acid, E- |
| Wikipedia | Cinnamic acid |
| PubChem | 444539 |
| ChemIDPlus | 000140103; 000538421; 000621829; 000588625; 016089488; 023588876 |
| ChemSpider | 392447 |
| HMDb | HMDB00930; HMDB00567 |
| KEGG | C00423; C10438 |
| ChEMBL | CHEMBL27246 |
| ChEBI | CHEBI:35697 |