Systematic / IUPAC Name: 3-(3,4-Dihydroxyphenyl)propanoic acid
ID: Reference142
Other Names:
3,4-Dihydroxyhydrocinnamic acid;
3,4-Dihydroxyhydrocinnamate;
3,4-Dihydroxybenzenepropionic acid;
Benzenepropanoic acid, 3,4-dihydroxy-;
3,4-Dihydroxyphenylpropionate
; more
Formula: C9H10O4
Class: Endogenous Metabolites
3,4-Dihydroxyphenylpropionic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 2 |
| No. of Spectra | 338 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | ESI; NSI |
| Analyzers | IT; FT |
| Last Modification | 11/6/2014 2:52:04 PM |
| InChI | InChI=1S/C9H10O4/c10-7-3-1-6(5-8(7)11)2-4-9(12)13/h1,3,5,10-11H,2,4H2,(H,12,13) |
| InChI Key | DZAUWHJDUNRCTF-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=C(C=C1CCC(=O)O)O)O |
| CAS | 1078611 |
| Splash | |
| Other Names |
3,4-Dihydroxyhydrocinnamic acid; 3,4-Dihydroxyhydrocinnamate; 3,4-Dihydroxybenzenepropionic acid; Benzenepropanoic acid, 3,4-dihydroxy-; 3,4-Dihydroxyphenylpropionate; 3-(3,4-Dihydroxyphenyl)propionate; 3,4-Dihydroxy-β-phenylpropionate; 3,4-Dihydroxy-β-phenylpropionic acid; Dihydrocaffeic acid; Dihydrocaffeate |
| ChEMBL | CHEMBL136927 |
| PubChem | 348154 |
| KEGG | C10447 |
| ChEBI | CHEBI:48400 |
| ChemSpider | 308986 |
| HMDb | HMDB00423 |
| ChemIDPlus | 071693953 |