Systematic / IUPAC Name: 2-Cyclopentylphenol
ID: Reference1448
Other Names: Phenol, 2-cyclopentyl-
Formula: C11H14O
2-Cyclopentylphenol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 71 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/3/2014 12:54:09 PM |
| InChI | InChI=1S/C11H14O/c12-11-8-4-3-7-10(11)9-5-1-2-6-9/h3-4,7-9,12H,1-2,5-6H2 |
| InChI Key | JHEKSKQMOBLXQS-UHFFFAOYSA-N |
| Canonical SMILES | C1CCC(C1)C2=CC=CC=C2O |
| CAS | 1518849 |
| Splash | |
| Other Names | Phenol, 2-cyclopentyl- |
| ChemSpider | 72526 |
| ChEMBL | CHEMBL111194 |
| PubChem | 80285 |
| ChemIDPlus | 001518849 |