Systematic / IUPAC Name: 6-O-Phosphono-D-glucopyranose
ID: Reference1467
Other Names:
D-Glucopyranose 6-(dihydrogen phosphate);
D-Glucose 6-phosphate;
(3,4,5,6-Tetrahydroxytetrahydropyran-2-yl)methoxyphosphonic acid;
Robison ester
Formula: C6H13O9P
Class: Endogenous Metabolites
D-Glucose 6-phosphate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Q Exactive Orbitrap |
| No. of Spectral Trees | 3 |
| No. of Spectra | 382 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/25/2016 6:00:25 AM |
| InChI | InChI=1S/C6H13O9P/c7-3-2(1-14-16(11,12)13)15-6(10)5(9)4(3)8/h2-10H,1H2,(H2,11,12,13)/t2-,3-,4+,5-,6?/m1/s1 |
| InChI Key | NBSCHQHZLSJFNQ-GASJEMHNSA-N |
| Canonical SMILES | C(C1C(C(C(C(O1)O)O)O)O)OP(=O)(O)O |
| CAS | 56735 |
| Splash | |
| Other Names |
D-Glucopyranose 6-(dihydrogen phosphate); D-Glucose 6-phosphate; (3,4,5,6-Tetrahydroxytetrahydropyran-2-yl)methoxyphosphonic acid; Robison ester |
| ChEBI | CHEBI:4170 |
| ChemIDPlus | 000056735; 000299310 |
| Wikipedia | Glucose 6-phosphate |
| PubChem | 5958 |
| ChemSpider | 17216117 |
| HMDb | HMDB01401 |
| KEGG | C00092 |