Systematic / IUPAC Name: [(2R,3S,4R,5R)-5-(2-Amino-6-oxo-1,6-dihydro-9H-purin-9-yl)-3,4-dihydroxytetrahydro-2-furanyl]methyl (2R,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyltetrahydro-2H-pyran-2-yl dihydrogen diphosphate (non-preferred name)
ID: Reference1487
Other Names:
GDP-β-L-fucose;
GDP-fucose;
Guanosine 5'-diphospho-fucose;
6-Deoxy-β-L-galactopyranosylguanosine 5'-diphosphate
Formula: C16H25N5O15P2
Class: Endogenous Metabolites
Guanosine 5'-diphospho-ß-L-fucose mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 212 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/3/2014 11:02:14 AM |
| InChI | InChI=1S/C16H25N5O15P2/c1-4-7(22)9(24)11(26)15(33-4)35-38(30,31)36-37(28,29)32-2-5-8(23)10(25)14(34-5)21-3-18-6-12(21)19-16(17)20-13(6)27/h3-5,7-11,14-15,22-26H,2H2,1H3,(H,28,29)(H,30,31)(H3,17,19,20,27)/t4-,5+,7+,8+,9+,10+,11-,14+,15+/m0/s1 |
| InChI Key | LQEBEXMHBLQMDB-JGQUBWHWSA-N |
| Canonical SMILES | CC1C(C(C(C(O1)OP(=O)(O)OP(=O)(O)OCC2C(C(C(O2)N3C=NC4=C3NC(=NC4=O)N)O)O)O)O)O |
| CAS | 15839700 |
| Splash | |
| Other Names |
GDP-β-L-fucose; GDP-fucose; Guanosine 5'-diphospho-fucose; 6-Deoxy-β-L-galactopyranosylguanosine 5'-diphosphate |
| ChEMBL | CHEMBL1229250 |
| KEGG | C00325 |
| ChEBI | CHEBI:13332 |
| ChemSpider | 10918995 |
| PubChem | 10918995 |