Systematic / IUPAC Name: 2-Hydroxy-4-(methylsulfanyl)butanoic acid
ID: Reference149
Other Names:
2-Hydroxy-4-(methylthio)butyric acid;
Butanoic acid, 2-hydroxy-4-(methylthio)-;
2-Hydroxy-4-(methylthio)butanoic acid;
Butyric acid, 2-hydroxy-4-(methylthio)-;
α-Hydroxy-Υ-(methylthio)butyric acid
; more
Formula: C5H10O3S
Class: Excipients/Additives/Colorants
2-Hydroxy-4-methylthiobutanoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 126 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/10/2014 10:00:41 AM |
| InChI | InChI=1S/C5H10O3S/c1-9-3-2-4(6)5(7)8/h4,6H,2-3H2,1H3,(H,7,8) |
| InChI Key | ONFOSYPQQXJWGS-UHFFFAOYSA-N |
| Canonical SMILES | CSCCC(C(=O)O)O |
| CAS | 583915 |
| Splash | |
| Other Names |
2-Hydroxy-4-(methylthio)butyric acid; Butanoic acid, 2-hydroxy-4-(methylthio)-; 2-Hydroxy-4-(methylthio)butanoic acid; Butyric acid, 2-hydroxy-4-(methylthio)-; α-Hydroxy-Υ-(methylthio)butyric acid; Υ-(Methylthio)-α-hydroxybutyric acid; Alimet; Desmeninol; MHA acid |