Systematic / IUPAC Name: D-Glucaric acid
ID: Reference1498
Other Names:
(2R,3S,4S,5S)-2,3,4,5-Tetrahydroxyhexanedioic acid;
D-Tetrahydroxyadipate;
D-Tetrahydroxyadipic acid;
D-Glucarate;
D-Glucosaccharic acid
; more
Formula: C6H10O8
Class: Endogenous Metabolites
D-Saccharic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 1962 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 12/3/2014 9:48:13 AM |
| InChI | InChI=1S/C6H10O8/c7-1(3(9)5(11)12)2(8)4(10)6(13)14/h1-4,7-10H,(H,11,12)(H,13,14)/t1-,2-,3-,4+/m0/s1 |
| InChI Key | DSLZVSRJTYRBFB-LLEIAEIESA-N |
| Canonical SMILES | C(C(C(C(=O)O)O)O)(C(C(=O)O)O)O |
| CAS | 87730 |
| Splash | |
| Other Names |
(2R,3S,4S,5S)-2,3,4,5-Tetrahydroxyhexanedioic acid; D-Tetrahydroxyadipate; D-Tetrahydroxyadipic acid; D-Glucarate; D-Glucosaccharic acid; D-(+)-Saccharic acid; D-Saccharate |