Systematic / IUPAC Name: 1-O-Phosphono-D-mannitol
ID: Reference1501
Other Names:
Mannitol 1-phosphate;
Mannitol 1-phosphic acid
Formula: C6H15O9P
Class: Endogenous Metabolites
D-Mannitol 1-phosphate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 127 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/3/2014 8:45:39 AM |
| InChI | InChI=1S/C6H15O9P/c7-1-3(8)5(10)6(11)4(9)2-15-16(12,13)14/h3-11H,1-2H2,(H2,12,13,14)/t3-,4-,5-,6-/m1/s1 |
| InChI Key | GACTWZZMVMUKNG-KVTDHHQDSA-N |
| Canonical SMILES | C(C(C(C(C(COP(=O)(O)O)O)O)O)O)O |
| CAS | 15806481 |
| Splash | |
| Other Names |
Mannitol 1-phosphate; Mannitol 1-phosphic acid |
| ChEBI | CHEBI:16298 |
| ChemSpider | 115387 |
| Wikipedia | Mannitol-1-phosphatase |
| ChemIDPlus | 015806481 |
| HMDb | HMDB01530 |
| PubChem | 130418 |
| KEGG | C00644 |