Systematic / IUPAC Name: (17β)-Estra-1,3,5(10)-triene-2,3,17-triol
ID: Reference1515
Other Names:
2-Hydroxy-17β-estradiol;
2,3,17b-Trihydroxyestra-1,3,5(10)-triene;
17β-2-Hydroxyestradiol;(17β)-estra-1,3, 5 (10)-triene-2,3,17-triol;
Estra-1,3,5(10)-triene-2,3,17β-triol;
1,3,5(10)-Estratriene-2,3,17β-triol
Formula: C18H24O3
Class: Endogenous Metabolites
2-Hydroxyestradiol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 310 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/3/2014 7:59:48 AM |
| InChI | InChI=1S/C18H24O3/c1-18-7-6-11-12(14(18)4-5-17(18)21)3-2-10-8-15(19)16(20)9-13(10)11/h8-9,11-12,14,17,19-21H,2-7H2,1H3/t11-,12+,14-,17-,18-/m0/s1 |
| InChI Key | DILDHNKDVHLEQB-XSSYPUMDSA-N |
| Canonical SMILES | CC12CCC3C(C1CCC2O)CCC4=CC(=C(C=C34)O)O |
| CAS | 362050 |
| Splash | |
| Other Names |
2-Hydroxy-17β-estradiol; 2,3,17b-Trihydroxyestra-1,3,5(10)-triene; 17β-2-Hydroxyestradiol;(17β)-estra-1,3, 5 (10)-triene-2,3,17-triol; Estra-1,3,5(10)-triene-2,3,17β-triol; 1,3,5(10)-Estratriene-2,3,17β-triol |
| ChemSpider | 216475 |
| KEGG | C05301 |
| PubChem | 247304 |
| ChEBI | CHEBI:28744 |
| ChEMBL | CHEMBL467987 |
| HMDb | HMDB00338 |