Systematic / IUPAC Name: 3,5-Dibromo-4-hydroxybenzoic acid
ID: Reference1521
Other Names:
Benzoic acid, 3,5-dibromo-4-hydroxy-;
Dibromoxynylbenzoic acid
Formula: C7H4Br2O3
3,5-Dibromo-4-hydroxybenzoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | LTQ Orbitrap XL |
| No. of Spectral Trees | 1 |
| No. of Spectra | 68 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/2/2014 3:32:26 PM |
| InChI | InChI=1S/C7H4Br2O3/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1-2,10H,(H,11,12) |
| InChI Key | PHWAJJWKNLWZGJ-UHFFFAOYSA-N |
| Canonical SMILES | C1=C(C=C(C(=C1Br)O)Br)C(=O)O |
| CAS | 3337620 |
| Splash | |
| Other Names |
Benzoic acid, 3,5-dibromo-4-hydroxy-; Dibromoxynylbenzoic acid |
| ChEBI | CHEBI:1395 |
| ChemSpider | 69309 |
| ChemIDPlus | 003337620 |
| KEGG | C03925 |
| PubChem | 76857 |