Systematic / IUPAC Name: D-Galactonic acid
ID: Reference1530
Other Names: (2R,3S,4S,5R)-2,3,4,5,6-Pentahydroxyhexanoic acid
Formula: C6H12O7
Class: Endogenous Metabolites
Galactonic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 165 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/2/2014 2:57:26 PM |
| InChI | InChI=1S/C6H12O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h2-5,7-11H,1H2,(H,12,13)/t2-,3+,4+,5-/m1/s1 |
| InChI Key | RGHNJXZEOKUKBD-MGCNEYSASA-N |
| Canonical SMILES | C(C(C(C(C(C(=O)O)O)O)O)O)O |
| CAS | 576363 |
| Splash | |
| Other Names | (2R,3S,4S,5R)-2,3,4,5,6-Pentahydroxyhexanoic acid |