Systematic / IUPAC Name: 2-(2,4-Dichlorophenoxy)propanoic acid
ID: Reference1551
Other Names:
2,4-Dichlorophenoxy-α-propionic acid;
α-(2,4-Dichlorophenoxy)propionic acid;
Propionic acid, 2-(2,4-dichlorophenoxy)-;
Hormatox;
Polymone
; more
Formula: C9H8Cl2O3
Class: Pesticides/Herbicides Industrial Chemicals
2,4-Dichlorophenoxypropionic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 780 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 4/1/2019 7:47:42 AM |
| InChI | InChI=1S/C9H8Cl2O3/c1-5(9(12)13)14-8-3-2-6(10)4-7(8)11/h2-5H,1H3,(H,12,13) |
| InChI Key | MZHCENGPTKEIGP-UHFFFAOYSA-N |
| Canonical SMILES | CC(C(=O)O)OC1=C(C=C(C=C1)Cl)Cl |
| CAS | 120365 |
| Splash | |
| Other Names |
2,4-Dichlorophenoxy-α-propionic acid; α-(2,4-Dichlorophenoxy)propionic acid; Propionic acid, 2-(2,4-dichlorophenoxy)-; Hormatox; Polymone; Polytox; Kildip; Herbizid DP; Hedonal DP; Cornox RK; Seritox 50; Cornoxynil; Mayclene; Polyclene; Weedone dp; Cornox rd; Textrone m; Oxytril P; Canapur DP; Dikofag DP; Propanoic acid, 2-(2,4-dichlorophenoxy)-; Ustilan NK25; Weedone 170; Cornox RK 64; Envert 171; Weedone 2,4-DP |
| Wikipedia | Dichlorprop |
| KEGG | C11020 |
| PubChem | 8427 |
| ChemSpider | 8120 |
| ChEMBL | CHEMBL573221 |
| ChEBI | CHEBI:75370 |
| ChemIDPlus | 000120365; 039283722; EE4133403; 005746178; 037341063; 028692355; 039104308 |