Systematic / IUPAC Name: N-[4-(1,3-Thiazol-2-ylsulfamoyl)phenyl]acetamide
ID: Reference1554
Other Names:
N-{4-[N-(Thiazol-2-yl)sulfamoyl]phenyl}acetamide ;
p-(2-Thiazolylsulfamyl)acetanilide;
Acetamide, N-{4-[(2-thiazolylamino)sulfonyl]phenyl}- ;
Benzenesulfonamide, 4-acetylamino-N-(2-thiazolyl)-
Formula: C11H11N3O3S2
N4-Acetylsulfathiazol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | LTQ Orbitrap XL |
| No. of Spectral Trees | 1 |
| No. of Spectra | 34 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/13/2015 1:17:59 PM |
| InChI | InChI=1S/C11H11N3O3S2/c1-8(15)13-9-2-4-10(5-3-9)19(16,17)14-11-12-6-7-18-11/h2-7H,1H3,(H,12,14)(H,13,15) |
| InChI Key | KXNXWINFSDKMHD-UHFFFAOYSA-N |
| Canonical SMILES | CC(=O)NC1=CC=C(C=C1)S(=O)(=O)NC2=NC=CS2 |
| CAS | 127764 |
| Splash | |
| Other Names |
N-{4-[N-(Thiazol-2-yl)sulfamoyl]phenyl}acetamide ; p-(2-Thiazolylsulfamyl)acetanilide; Acetamide, N-{4-[(2-thiazolylamino)sulfonyl]phenyl}- ; Benzenesulfonamide, 4-acetylamino-N-(2-thiazolyl)- |
| ChEMBL | CHEMBL1350909 |
| ChemSpider | 60527 |
| ChemIDPlus | 000127764 |
| PubChem | 67183 |