Systematic / IUPAC Name: Methyl [5-(propylsulfinyl)-1H-benzimidazol-2-yl]carbamate
ID: Reference1563
Other Names:
Ricobendazole;
Albendazole S-oxide;
Rycobendazole;
Carbamic acid, (5-propylsulfinyl)-1H-benzimidazol-2-yl)-, methyl ester;
Albendazole sulphoxide
Formula: C12H15N3O3S
Class: Pesticides/Herbicides
Albendazole sulfoxide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 3 |
| No. of Spectra | 286 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/2/2014 1:32:27 PM |
| InChI | InChI=1S/C12H15N3O3S/c1-3-6-19(17)8-4-5-9-10(7-8)14-11(13-9)15-12(16)18-2/h4-5,7H,3,6H2,1-2H3,(H2,13,14,15,16) |
| InChI Key | VXTGHWHFYNYFFV-UHFFFAOYSA-N |
| Canonical SMILES | CCCS(=O)C1=CC2=C(C=C1)N=C(N2)NC(=O)OC |
| CAS | 54029128 |
| Splash | |
| Other Names |
Ricobendazole; Albendazole S-oxide; Rycobendazole; Carbamic acid, (5-propylsulfinyl)-1H-benzimidazol-2-yl)-, methyl ester; Albendazole sulphoxide; Methoxy-N-[5-(propylsulfinyl)benzimidazol-2-yl]carboxamide |
| ChemIDPlus | 054029128 |
| ChemSpider | 75767 |
| ChEMBL | CHEMBL1665 |
| ChEBI | CHEBI:16959 |
| PubChem | 83969 |
| KEGG | C02809; D07106 |