Systematic / IUPAC Name: N-Benzyl-1H-purin-6-amine
ID: Reference1576
Other Names:
6-Benzylaminopurine;
6-Benzyladenine;
Adenine, N-benzyl-;
1H-Purin-6-amine, N-(phenylmethyl)-;
Aminopurine, 6-benzyl
; more
Formula: C12H11N5
Class: Pesticides/Herbicides
Benzyladenine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 41 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/2/2014 1:11:50 PM |
| InChI | InChI=1S/C12H11N5/c1-2-4-9(5-3-1)6-13-11-10-12(15-7-14-10)17-8-16-11/h1-5,7-8H,6H2,(H2,13,14,15,16,17) |
| InChI Key | NWBJYWHLCVSVIJ-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)CNC2=NC=NC3=C2NC=N3 |
| CAS | 1214397 |
| Splash | |
| Other Names |
6-Benzylaminopurine; 6-Benzyladenine; Adenine, N-benzyl-; 1H-Purin-6-amine, N-(phenylmethyl)-; Aminopurine, 6-benzyl; Benzyl(purin-6-yl)amine; N-(Phenylmethyl)-1H-purin-6-amine; N6-Benzyladenine; N6-Benzylaminopurine; 9H-Purin-6-amine, N-(phenylmethyl)-; Benzylpurin-6-ylamine; 6-[(Phenylmethyl)amino]-9H-purine |
| ChEMBL | CHEMBL228862 |
| KEGG | C11263 |
| PubChem | 62389 |
| Wikipedia | 6-Benzylaminopurine |
| ChemSpider | 56177 |
| ChemIDPlus | 001214397 |
| HMDb | HMDB39238 |
| ChEBI | CHEBI:29022 |