Systematic / IUPAC Name: 5-Ethyl-5-(2-pentanyl)-2-thioxodihydro-4,6(1H,5H)-pyrimidinedione
ID: Reference1587
Other Names:
5-Ethyl-5-(1-methylbutyl)-2-thiobarbituric acid;
2-Thio-5-ethyl-5-sec-pentylbarbituric acid;
4,6(1H,5H)-Pyrimidinedione, 5-ethyldihydro-5-(1-methylbutyl)-2-thioxo-;
Barbituric acid, 5-ethyl-5-(1-methylbutyl)-2-thio-;
5-Ethyl-5-(1-methyl-butyl)-2-thioxo-dihydro-pyrimidine-4,6-dione
; more
Formula: C11H18N2O2S
Class: Therapeutics/Prescription Drugs
Thiopental mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | LTQ Orbitrap XL; Q Exactive HF Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 113 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/20/2015 1:49:37 PM |
| InChI | InChI=1S/C11H18N2O2S/c1-4-6-7(3)11(5-2)8(14)12-10(16)13-9(11)15/h7H,4-6H2,1-3H3,(H2,12,13,14,15,16) |
| InChI Key | IUJDSEJGGMCXSG-UHFFFAOYSA-N |
| Canonical SMILES | CCCC(C)C1(C(=O)NC(=S)NC1=O)CC |
| CAS | 76755 |
| Splash | |
| Other Names |
5-Ethyl-5-(1-methylbutyl)-2-thiobarbituric acid; 2-Thio-5-ethyl-5-sec-pentylbarbituric acid; 4,6(1H,5H)-Pyrimidinedione, 5-ethyldihydro-5-(1-methylbutyl)-2-thioxo-; Barbituric acid, 5-ethyl-5-(1-methylbutyl)-2-thio-; 5-Ethyl-5-(1-methyl-butyl)-2-thioxo-dihydro-pyrimidine-4,6-dione; 5-Ethyl-2-mercapto-5-(1-methylbutyl)pyrimidine-4,6(1H,5H)-dione; Thiopentone; Penthiobarbital; Thiomebumal; Thionembutal; Pentothiobarbital; Thiopentobarbital; Intraval; Trapanal; Thiopentobarbitone; Thiopentobarbituric acid; Thiothal; Tiopentale |
| Wikipedia | Thiopental |
| ChemIDPlus | 000071738; 000076755 |
| PubChem | 3000715 |
| KEGG | C07521; D00714 |
| ChemSpider | 2272258 |
| DrugBank | APRD00660 |
| ChEMBL | CHEMBL441 |
| ChEBI | CHEBI:102166 |