Systematic / IUPAC Name: 9-(2-Deoxypentofuranosyl)-9H-purin-6-amine
ID: Reference159
Other Names:
1-(6-Amino-9H-purin-9-yl)-1,2-dideoxy-β-δ-ribofuranose;
Deoxyadenosine;
Adenine deoxyribonucleoside;
Adenine deoxyribose;
Desoxyadenosine
; more
Formula: C10H13N5O3
Class: Endogenous Metabolites
2'-Deoxyadenosine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | LTQ Orbitrap XL; Orbitrap Elite; Q Exactive Orbitrap |
| No. of Spectral Trees | 7 |
| No. of Spectra | 968 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | ESI; APCI; NSI |
| Analyzers | FT |
| Last Modification | 11/11/2014 10:05:09 AM |
| InChI | InChI=1S/C10H13N5O3/c11-9-8-10(13-3-12-9)15(4-14-8)7-1-5(17)6(2-16)18-7/h3-7,16-17H,1-2H2,(H2,11,12,13)/t5-,6+,7+/m0/s1 |
| InChI Key | OLXZPDWKRNYJJZ-RRKCRQDMSA-N |
| Canonical SMILES | n2c1c(ncnc1n(c2)C3OC(C(O)C3)CO)N |
| CAS | 958098 |
| Splash | |
| Other Names |
1-(6-Amino-9H-purin-9-yl)-1,2-dideoxy-β-δ-ribofuranose; Deoxyadenosine; Adenine deoxyribonucleoside; Adenine deoxyribose; Desoxyadenosine; 2-Deoxyadenosine; 9-(2-Deoxy-β-δ-erythro-pentofuranosyl)adenine; 9-(2-Deoxy-β-δ-ribofuranosyl)-9H-purin-6-amine; 9-(2-Deoxy-β-δ-erythro-pentofuranosyl)-9H-purin-6-amine |
| HMDb | HMDB00101 |
| ChemSpider | 13135 |
| Wikipedia | Deoxyadenosine |
| KEGG | C00559 |
| ChemIDPlus | 000958098; 040627143; 016373936 |
| PubChem | 13730 |
| ChEMBL | CHEMBL449329 |
| ChEBI | CHEBI:17256 |