Systematic / IUPAC Name: S-Ethyl cyclohexyl(ethyl)carbamothioate
ID: Reference1591
Other Names:
Hexylthiocarbam;
Carbamothioic acid, cyclohexylethyl, S-ethyl ester;
S-Ethyl cyclohexylethylthiocarbamate;
S-Ethyl N-ethylcyclohexanecarbamothioate;
S-Ethyl N-ethyl-N-cyclohexylthiolcarbamate
; more
Formula: C11H21NOS
Class: Pesticides/Herbicides
Cycloate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Orbitrap |
| No. of Spectral Trees | 3 |
| No. of Spectra | 519 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 12/2/2014 12:56:51 PM |
| InChI | InChI=1S/C11H21NOS/c1-3-12(11(13)14-4-2)10-8-6-5-7-9-10/h10H,3-9H2,1-2H3 |
| InChI Key | DFCAFRGABIXSDS-UHFFFAOYSA-N |
| Canonical SMILES | CCN(C1CCCCC1)C(=O)SCC |
| CAS | 1134232 |
| Splash | |
| Other Names |
Hexylthiocarbam; Carbamothioic acid, cyclohexylethyl, S-ethyl ester; S-Ethyl cyclohexylethylthiocarbamate; S-Ethyl N-ethylcyclohexanecarbamothioate; S-Ethyl N-ethyl-N-cyclohexylthiolcarbamate; S-Ethyl N-cyclohexyl-N-ethyl(thiocarbamate); Carbamic acid, cyclohexylethylthio, S-ethyl ester; Cyclohexanecarbamic acid, N-ethylthio, S-ethyl ester; Etsan; Eurex; Ronit; Sabet |
| Wikipedia | Cycloat (DE) |
| PubChem | 14337 |
| ChemIDPlus | 001134232 |
| ChEMBL | CHEMBL1889969 |
| KEGG | C18780 |
| ChemSpider | 13698 |