Systematic / IUPAC Name: Furan-2-carboxylic acid
ID: Reference162
Other Names:
2-Furancarboxylic acid;
Furancarboxylic acid;
α-Furancarboxylic acid;
Furancarboxylate;
α-Furancarboxylate
; more
Formula: C5H4O3
Class: Industrial Chemicals
2-Furoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Q Exactive Orbitrap |
| No. of Spectral Trees | 3 |
| No. of Spectra | 312 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/11/2014 2:34:57 PM |
| InChI | InChI=1S/C5H4O3/c6-5(7)4-2-1-3-8-4/h1-3H,(H,6,7) |
| InChI Key | SMNDYUVBFMFKNZ-UHFFFAOYSA-N |
| Canonical SMILES | C1=COC(=C1)C(=O)O |
| CAS | 88142 |
| Splash | |
| Other Names |
2-Furancarboxylic acid; Furancarboxylic acid; α-Furancarboxylic acid; Furancarboxylate; α-Furancarboxylate; Pyromucic acid; 2-Carboxyfuran; α-Furoic acid; 2-Furanoic acid; Pyromucate; Furoate; α-Furoate; 2-Furanoate |
| ChEBI | CHEBI:30845 |
| Wikipedia | 2-Furoic acid |
| HMDb | HMDB00617 |
| KEGG | C01546 |
| ChemSpider | 10251740 |
| ChEMBL | CHEMBL1232797 |