Systematic / IUPAC Name: 2-[(2-Methylbenzoyl)amino]acetic acid
ID: Reference165
Other Names:
N-(2-Methylbenzoyl)glycine;
o-Methylhippuric acid;
Glycine, N-(2-methylbenzoyl)-;
N-(Methylbenzoyl)glycine;
Glycine, N-(methylbenzoyl)-
; more
Formula: C10H11NO3
Class: Endogenous Metabolites
2-Methylhippuric acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 3 |
| No. of Spectra | 519 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 11/12/2014 2:52:39 PM |
| InChI | InChI=1S/C10H11NO3/c1-7-4-2-3-5-8(7)10(14)11-6-9(12)13/h2-5H,6H2,1H3,(H,11,14)(H,12,13) |
| InChI Key | YOEBAVRJHRCKRE-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CC=CC=C1C(=O)NCC(=O)O |
| CAS | 42013207 |
| Splash | |
| Other Names |
N-(2-Methylbenzoyl)glycine; o-Methylhippuric acid; Glycine, N-(2-methylbenzoyl)-; N-(Methylbenzoyl)glycine; Glycine, N-(methylbenzoyl)-; o-Toluric acid; N-(o-Toluoyl)glycine |
| ChemIDPlus | 042013207; 066940327 |
| ChemSpider | 82742 |
| ChEMBL | CHEMBL457228 |
| PubChem | 91637 |
| ChEBI | CHEBI:68455 |
| HMDb | HMDB11723 |