Systematic / IUPAC Name: 4-(Dipropylamino)-3,5-dinitrobenzenesulfonamide
ID: Reference1666
Other Names:
Surflan;
Dirimal;
Ryzelan;
Dirimal extra;
Benzenesulfonamide, 4-(dipropylamino)-3,5-dinitro-
; more
Formula: C12H18N4O6S
Class: Pesticides/Herbicides
Oryzalin mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Orbitrap |
| No. of Spectral Trees | 9 |
| No. of Spectra | 7745 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | ESI; APCI; NSI |
| Analyzers | FT |
| Last Modification | 2/12/2015 1:06:03 PM |
| InChI | InChI=1S/C12H18N4O6S/c1-3-5-14(6-4-2)12-10(15(17)18)7-9(23(13,21)22)8-11(12)16(19)20/h7-8H,3-6H2,1-2H3,(H2,13,21,22) |
| InChI Key | UNAHYJYOSSSJHH-UHFFFAOYSA-N |
| Canonical SMILES | CCCN(CCC)C1=C(C=C(C=C1[N+](=O)[O-])S(=O)(=O)N)[N+](=O)[O-] |
| CAS | 19044883 |
| Splash | |
| Other Names |
Surflan; Dirimal; Ryzelan; Dirimal extra; Benzenesulfonamide, 4-(dipropylamino)-3,5-dinitro-; 3,5-Dinitro-N4,N4-dipropylsulfanilamide; 3,5-Dinitro-N4,N4-dipropylsulphanilamide; Rycelan; Rycelon |
| PubChem | 29393 |
| ChEMBL | CHEMBL295960 |
| ChemSpider | 27326 |
| KEGG | C18877 |
| ChemIDPlus | 019044883; 073306259; 110297331 |
| Wikipedia | Oryzalin |
| ChEBI | CHEBI:73163 |