Systematic / IUPAC Name: 2-[(4-Methylbenzoyl)amino]acetic acid
ID: Reference167
Other Names:
N-(4-Methylbenzoyl)glycine;
p-Methylhippuric acid;
4-Methylbenzoylglycine;
4-Methyl hippuric acid;
2-[(4-Methylphenyl)formamido]acetic acid
; more
Formula: C10H11NO3
Class: Industrial Chemicals
4-Methylhippuric acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 2 |
| No. of Spectra | 227 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/12/2014 3:14:08 PM |
| InChI | InChI=1S/C10H11NO3/c1-7-2-4-8(5-3-7)10(14)11-6-9(12)13/h2-5H,6H2,1H3,(H,11,14)(H,12,13) |
| InChI Key | NRSCPTLHWVWLLH-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CC=C(C=C1)C(=O)NCC(=O)O |
| CAS | 27115500 |
| Splash | |
| Other Names |
N-(4-Methylbenzoyl)glycine; p-Methylhippuric acid; 4-Methylbenzoylglycine; 4-Methyl hippuric acid; 2-[(4-Methylphenyl)formamido]acetic acid; N-[(4-Methylphenyl)carbonyl]glycine; 2-[(4-Methylphenyl)carbonylamino]acetic acid; Hippuric acid, p-methyl-; N-(p-Methylbenzoyl)glycine; Glycine, N-(4-methylbenzoyl)-; 2-(4-Methylbenzamido)acetic acid; ((4-Methylbenzoyl)amino)acetic acid; p-Toluric acid; N-(p-Toluoyl)glycine |
| PubChem | 97479 |
| ChEMBL | CHEMBL274877 |
| ChemIDPlus | 027115500 |
| ChEBI | CHEBI:68552 |
| HMDb | HMDB13292 |
| ChemSpider | 87986 |