Systematic / IUPAC Name: 5-Chloro-N-{2-[4-(2-ethoxyethyl)-2,3-dimethylphenoxy]ethyl}-6-ethylpyrimidin-4-amine
ID: Reference1680
Other Names: 5-Chloro-N-{2-[4-(2-ethoxyethyl)-2,3-dimethylphenoxy]ethyl}-6-ethyl-4-pyrimidinamine
Formula: C20H28ClN3O2
Class: Pesticides/Herbicides
Pyrimidifen mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 86 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/23/2015 11:22:49 AM |
| InChI | InChI=1S/C20H28ClN3O2/c1-5-17-19(21)20(24-13-23-17)22-10-12-26-18-8-7-16(9-11-25-6-2)14(3)15(18)4/h7-8,13H,5-6,9-12H2,1-4H3,(H,22,23,24) |
| InChI Key | ITKAIUGKVKDENI-UHFFFAOYSA-N |
| Canonical SMILES | CCC1=C(C(=NC=N1)NCCOC2=C(C(=C(C=C2)CCOCC)C)C)Cl |
| CAS | 105779780 |
| Splash | |
| Other Names | 5-Chloro-N-{2-[4-(2-ethoxyethyl)-2,3-dimethylphenoxy]ethyl}-6-ethyl-4-pyrimidinamine |
| ChemIDPlus | 105779780 |
| PubChem | 6451139 |
| ChemSpider | 4953620 |
| ChEBI | CHEBI:38604 |
| KEGG | C18603 |