Systematic / IUPAC Name: 2-Chloroprop-2-enyl N,N-diethylcarbamodithioate
ID: Reference1691
Other Names:
CDEC;
Thioallate;
Vegadex;
Vegadex super;
2-Chloroallyl diethyldithiocarbamate
; more
Formula: C8H14ClNS2
Class: Pesticides/Herbicides
Sulfallate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 86 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/12/2015 4:10:54 PM |
| InChI | InChI=1S/C8H14ClNS2/c1-4-10(5-2)8(11)12-6-7(3)9/h3-6H2,1-2H3 |
| InChI Key | XJCLWVXTCRQIDI-UHFFFAOYSA-N |
| Canonical SMILES | CCN(CC)C(=S)SCC(=C)Cl |
| CAS | 95067 |
| Splash | |
| Other Names |
CDEC; Thioallate; Vegadex; Vegadex super; 2-Chloroallyl diethyldithiocarbamate; Vegedex; Carbamodithioic acid, diethyl, 2-chloro-2-propenyl ester; Chlorallyl diethyldithiocarbamate; 2-Chlorallyl diethyldithiocarbamate; 2-Chloroallyl N,N-diethyldithiocarbamate; Diethyldithiocarbamic acid 2-chloroallyl ester; 2-Chloro-2-propenyl diethylcarbamodithioate; 2-Chloroprop-2-en-1-yl diethyldithiocarbamate; 2-Chloro-2-propene-1-thiol diethyldithiocarbamate; Carbamic acid, diethyldithio, 2-chloroallyl ester; N,N-Diethyldithiocarbamic acid 2-chloroallyl ester; 2-Propene-1-thiol, 2-chloro, diethyldithiocarbamate; Diethylcarbamodithioic acid 2-chloro-2-propenyl ester; 2-Chloroprop-2-en-1-yl diethylcarbamodithioate; Carbamodithioic acid, diethyl, 2-chloro-2-propanyl ester; N,N-Diethyl[(2-chloroprop-2-en-1-yl)sulfanyl]carbothioamide |
| ChemIDPlus | 000095067 |
| PubChem | 7216 |
| ChemSpider | 6946 |
| ChEMBL | CHEMBL538146 |
| KEGG | C19096 |