Systematic / IUPAC Name: Ethyl N-{[2-(ethoxycarbonylcarbamothioylamino)phenyl]carbamothioyl}carbamate
ID: Reference1704
Other Names:
Thiophanate ethyl;
(1,2-Phenylenebis(iminocarbonothioyl))biscarbamic acid diethyl ester;
Carbamic acid, [1,2-phenylenebis(iminocarbonothioyl)]bis, diethyl ester;
Ethoxy-N-{[(2-{[(ethoxycarbonylamino)thioxomethyl]amino}phenyl)amino]thioxomet hyl}carboxamide;
1,2-Bis[3-(ethoxycarbonyl)thioureido]benzene
; more
Formula: C14H18N4O4S2
Class: Pesticides/Herbicides
Thiophanate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 86 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/13/2017 9:05:11 AM |
| InChI | InChI=1S/C14H18N4O4S2/c1-3-21-13(19)17-11(23)15-9-7-5-6-8-10(9)16-12(24)18-14(20)22-4-2/h5-8H,3-4H2,1-2H3,(H2,15,17,19,23)(H2,16,18,20,24) |
| InChI Key | YFNCATAIYKQPOO-UHFFFAOYSA-N |
| Canonical SMILES | CCOC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OCC |
| CAS | 23564069 |
| Splash | |
| Other Names |
Thiophanate ethyl; (1,2-Phenylenebis(iminocarbonothioyl))biscarbamic acid diethyl ester; Carbamic acid, [1,2-phenylenebis(iminocarbonothioyl)]bis, diethyl ester; Ethoxy-N-{[(2-{[(ethoxycarbonylamino)thioxomethyl]amino}phenyl)amino]thioxomet hyl}carboxamide; 1,2-Bis[3-(ethoxycarbonyl)thioureido]benzene; Diethyl (benzene-1,2-diyldicarbamothioyl)biscarbamate; Cercobin; Thiofanate; Thiophanat; Enovit; Topsin; Pelt; Nemafax; Vermadax; Topsin E; Thiophenite |
| ChemIDPlus | 023564069 |
| ChemSpider | 2297684 |
| ChEMBL | CHEMBL2103777 |
| KEGG | C18918 |
| PubChem | 3032792 |