Systematic / IUPAC Name: 2-Amino-3-methoxybenzoic acid
ID: Reference1726
Other Names:
3-Methoxyanthranilic acid;
Benzoic acid, 2-amino-3-methoxy-;
3-Methoxyanthranilate;
m-Anisic acid, 2-amino-;
3-Methoxy-2-aminobenzoic acid
; more
Formula: C8H9NO3
2-Amino-3-methoxybenzoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 134 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/2/2014 8:47:22 AM |
| InChI | InChI=1S/C8H9NO3/c1-12-6-4-2-3-5(7(6)9)8(10)11/h2-4H,9H2,1H3,(H,10,11) |
| InChI Key | SXOPCLUOUFQBJV-UHFFFAOYSA-N |
| Canonical SMILES | COC1=CC=CC(=C1N)C(=O)O |
| CAS | 3177808 |
| Splash | |
| Other Names |
3-Methoxyanthranilic acid; Benzoic acid, 2-amino-3-methoxy-; 3-Methoxyanthranilate; m-Anisic acid, 2-amino-; 3-Methoxy-2-aminobenzoic acid; 2-Amino-3-carboxyanisole; 2-Carboxy-6-methoxyaniline |
| ChemSpider | 224233 |
| ChEBI | CHEBI:27440 |
| KEGG | C05831 |
| PubChem | 255720 |
| HMDb | HMDB60374 |