Systematic / IUPAC Name: 4-Methoxy-3,5-dimethylbenzoic acid
ID: Reference1733
Other Names:
3,5-Dimethylanisic acid;
3,5-Dimethyl-p-anisic acid
Formula: C10H12O3
3,5-Dimethyl-4- methoxybenzoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 73 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/7/2015 11:06:24 AM |
| InChI | InChI=1S/C10H12O3/c1-6-4-8(10(11)12)5-7(2)9(6)13-3/h4-5H,1-3H3,(H,11,12) |
| InChI Key | WXVQURJGDUNJCS-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CC(=CC(=C1OC)C)C(=O)O |
| CAS | 21553468 |
| Splash | |
| Other Names |
3,5-Dimethylanisic acid; 3,5-Dimethyl-p-anisic acid |