Systematic / IUPAC Name: 3-Furoic acid
ID: Reference1735
Other Names:
Furan-3-carboxylic acid;
3-Carboxyfuran;
3-Furanoic acid;
3-Furoate
Formula: C5H4O3
Class: Endogenous Metabolites
3-Furoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 178 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 12/1/2014 5:20:13 PM |
| InChI | InChI=1S/C5H4O3/c6-5(7)4-1-2-8-3-4/h1-3H,(H,6,7) |
| InChI Key | IHCCAYCGZOLTEU-UHFFFAOYSA-N |
| Canonical SMILES | C1=COC=C1C(=O)O |
| CAS | 488937 |
| Splash | |
| Other Names |
Furan-3-carboxylic acid; 3-Carboxyfuran; 3-Furanoic acid; 3-Furoate |
| ChemSpider | 9849 |
| ChEBI | CHEBI:30846 |
| ChemIDPlus | 000488937 |
| PubChem | 10268 |
| HMDb | HMDB00444 |