Systematic / IUPAC Name: 4-Chloro-3-sulfamoylbenzoic acid
ID: Reference1743
Other Names:
3-(Aminosulfonyl)-4-chlorobenzoic acid;
Benzoic acid, 3-(aminosulfonyl)-4-chloro-;
4-Chloro-5-sulphamoylbenzoic acid;
Sulfamido-3-chlorobenzoic acid;
Benzoic acid, 4-chloro-3-sulfamoyl-
Formula: C7H6ClNO4S
Class: Therapeutics/Prescription Drugs
4-Chloro-3-sulfamoylbenzoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 73 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/1/2014 5:04:38 PM |
| InChI | InChI=1S/C7H6ClNO4S/c8-5-2-1-4(7(10)11)3-6(5)14(9,12)13/h1-3H,(H,10,11)(H2,9,12,13) |
| InChI Key | FHQAWINGVCDTTG-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=C(C=C1C(=O)O)S(=O)(=O)N)Cl |
| CAS | 1205307 |
| Splash | |
| Other Names |
3-(Aminosulfonyl)-4-chlorobenzoic acid; Benzoic acid, 3-(aminosulfonyl)-4-chloro-; 4-Chloro-5-sulphamoylbenzoic acid; Sulfamido-3-chlorobenzoic acid; Benzoic acid, 4-chloro-3-sulfamoyl- |