Systematic / IUPAC Name: 7-(2,3-Dihydroxypropyl)-1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione
ID: Reference1752
Other Names:
Dipropylline;
Dihydroxypropyl theophylline;
7-(β,Υ-Dihydroxypropyl)theophylline;
7-(2,3-Dihydroxypropyl)-1,3-dimethylxanthine;
1,3-Dimethyl-7-(2,3-dihydroxypropyl)xanthine
; more
Formula: C10H14N4O4
Class: Therapeutics/Prescription Drugs
7-(2,3-Dihydroxypropyl)theophylline mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 3 |
| No. of Spectra | 231 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/1/2014 4:47:35 PM |
| InChI | InChI=1S/C10H14N4O4/c1-12-8-7(9(17)13(2)10(12)18)14(5-11-8)3-6(16)4-15/h5-6,15-16H,3-4H2,1-2H3 |
| InChI Key | KSCFJBIXMNOVSH-UHFFFAOYSA-N |
| Canonical SMILES | CN1C2=C(C(=O)N(C1=O)C)N(C=N2)CC(CO)O |
| CAS | 479185 |
| Splash | |
| Other Names |
Dipropylline; Dihydroxypropyl theophylline; 7-(β,Υ-Dihydroxypropyl)theophylline; 7-(2,3-Dihydroxypropyl)-1,3-dimethylxanthine; 1,3-Dimethyl-7-(2,3-dihydroxypropyl)xanthine; 1H-Purine-2,6-dione, 7-(2,3-dihydroxypropyl)-3,7-dihydro-1,3-dimethyl-; Theophylline, 7-(2,3-dihydroxypropyl)-; Dyphylline; Diprophylline; Lufyllin; Corphyllin; Glyphylline; Neothylline; Aristophyllin; Asthmolysin; Astrophyllin; Diprofillin; Diprofilline; Hyphylline; Neophylline; Neostenovasan; Neutrafillina; Neutraphylline; Propyphyllin; Protheophylline; Silbephyllin; Silbephylline; Solufyllin; Soluphyllin; Synthophylline; Circain; Coronal; Coronarin; Droxine; Glyfyllin; Hiphyllin; Liactemin; Neotilina; Neutrafil; Purifilin; Solufilin; Tefilan; Thefylan; Dyflex; Neufil; Teofen; Theal; Afi-phyllin; Neophyl; Dilor; Astmamasit; Circair; Diphylline; Iphyllin; Isophyllen; Tesfen |
| ChemIDPlus | 000479185 |
| DrugBank | APRD00769 |
| PubChem | 3182 |
| ChEMBL | CHEMBL1752 |
| KEGG | C07819; D00691 |
| ChemSpider | 3070 |
| Wikipedia | Dyphylline |
| ChEBI | CHEBI:4728 |