Systematic / IUPAC Name: N-Ethylglycine
ID: Reference1789
Other Names:
2-(ethylamino)acetic acid;
Glycine, N-ethyl-
Formula: C4H9NO2
N-Ethylglycine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 122 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/1/2014 2:38:25 PM |
| InChI | InChI=1S/C4H9NO2/c1-2-5-3-4(6)7/h5H,2-3H2,1H3,(H,6,7) |
| InChI Key | YPIGGYHFMKJNKV-UHFFFAOYSA-N |
| Canonical SMILES | CCNCC(=O)O |
| CAS | 627010 |
| Splash | |
| Other Names |
2-(ethylamino)acetic acid; Glycine, N-ethyl- |
| HMDb | HMDB41945 |
| ChemSpider | 280126 |
| PubChem | 316542 |
| ChEBI | CHEBI:15620; CHEBI:57440 |
| KEGG | C11735 |