Systematic / IUPAC Name: 5,7-Dihydroxy-2-(4-hydroxyphenyl)-2,3-dihydro-4H-chromen-4-one
ID: Reference18
Other Names:
5,7-Dihydroxy-2-(4-hydroxyphenyl)chroman-4-one;
2,3-Dihydro-5,7-dihydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one
Formula: C15H12O5
Class: Endogenous Metabolites
Naringenin mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Orbitrap |
| No. of Spectral Trees | 4 |
| No. of Spectra | 1157 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 9/1/2025 6:04:02 PM |
| InChI | InChI=1S/C15H12O5/c16-9-3-1-8(2-4-9)13-7-12(19)15-11(18)5-10(17)6-14(15)20-13/h1-6,13,16-18H,7H2 |
| InChI Key | FTVWIRXFELQLPI-UHFFFAOYSA-N |
| Canonical SMILES | C1C(OC2=CC(=CC(=C2C1=O)O)O)C3=CC=C(C=C3)O |
| CAS | 480411 |
| Splash | |
| Other Names |
5,7-Dihydroxy-2-(4-hydroxyphenyl)chroman-4-one; 2,3-Dihydro-5,7-dihydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one |
| Wikipedia | Naringenin |
| ChEBI | CHEBI:50202 |
| PubChem | 932 |
| ChemIDPlus | 000480411; 067604482 |
| ChEMBL | CHEMBL32571 |
| ChemSpider | 907 |